C20H29ClN4O4 — CID 46381814
ethyl 2-[2-[1-[(3-chlorophenyl)carbamoyl]piperidin-4-yl]ethylcarbamoylamino]propanoate (PubChem CID 46381814) has the molecular formula C20H29ClN4O4 and a molecular weight of 424.93 g/mol. Its IUPAC name is ethyl 2-[2-[1-[(3-chlorophenyl)carbamoyl]piperidin-4-yl]ethylcarbamoylamino]propanoate.
| Compound Name | ethyl 2-[2-[1-[(3-chlorophenyl)carbamoyl]piperidin-4-yl]ethylcarbamoylamino]propanoate |
|---|---|
| PubChem CID | 46381814 |
| Molecular Formula | C20H29ClN4O4 |
| Molecular Weight | 424.93 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | ethyl 2-[2-[1-[(3-chlorophenyl)carbamoyl]piperidin-4-yl]ethylcarbamoylamino]propanoate |
| SMILES | CCOC(=O)C(C)NC(=O)NCCC1CCN(C(=O)Nc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C20H29ClN4O4/c1-3-29-18(26)14(2)23-19(27)22-10-7-15-8-11-25(12-9-15)20(28)24-17-6-4-5-16(21)13-17/h4-6,13-15H,3,7-12H2,1-2H3,(H,24,28)(H2,22,23,27) |
| InChIKey | XDYGJGQQXACXPT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.93 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |