C10H7ClF3N5 — CID 46397715
6-(chloromethyl)-2-N-(3,4,5-trifluorophenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 46397715) has the molecular formula C10H7ClF3N5 and a molecular weight of 289.65 g/mol. Its IUPAC name is 6-(chloromethyl)-2-N-(3,4,5-trifluorophenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(chloromethyl)-2-N-(3,4,5-trifluorophenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 46397715 |
| Molecular Formula | C10H7ClF3N5 |
| Molecular Weight | 289.65 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 6-(chloromethyl)-2-N-(3,4,5-trifluorophenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(CCl)nc(Nc2cc(F)c(F)c(F)c2)n1 |
| InChI | InChI=1S/C10H7ClF3N5/c11-3-7-17-9(15)19-10(18-7)16-4-1-5(12)8(14)6(13)2-4/h1-2H,3H2,(H3,15,16,17,18,19) |
| InChIKey | IBHPNUVDHWVKJI-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.65 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|