C22H32N6O3 — CID 46428685
N,N-diethyl-4-[[(1-ethyl-2-methylbenzimidazole-5-carbonyl)amino]carbamoyl]piperidine-1-carboxamide (PubChem CID 46428685) has the molecular formula C22H32N6O3 and a molecular weight of 428.54 g/mol. Its IUPAC name is N,N-diethyl-4-[[(1-ethyl-2-methylbenzimidazole-5-carbonyl)amino]carbamoyl]piperidine-1-carboxamide.
| Compound Name | N,N-diethyl-4-[[(1-ethyl-2-methylbenzimidazole-5-carbonyl)amino]carbamoyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 46428685 |
| Molecular Formula | C22H32N6O3 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | N,N-diethyl-4-[[(1-ethyl-2-methylbenzimidazole-5-carbonyl)amino]carbamoyl]piperidine-1-carboxamide |
| SMILES | CCN(CC)C(=O)N1CCC(C(=O)NNC(=O)c2ccc3c(c2)nc(C)n3CC)CC1 |
| InChI | InChI=1S/C22H32N6O3/c1-5-26(6-2)22(31)27-12-10-16(11-13-27)20(29)24-25-21(30)17-8-9-19-18(14-17)23-15(4)28(19)7-3/h8-9,14,16H,5-7,10-13H2,1-4H3,(H,24,29)(H,25,30) |
| InChIKey | SNCQXGKVLQQGCX-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 99.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|