C17H21N3OS — CID 4644875
N-tert-butyl-3-(4,6-dimethylpyrimidin-2-yl)sulfanylbenzamide (PubChem CID 4644875) has the molecular formula C17H21N3OS and a molecular weight of 315.44 g/mol. Its IUPAC name is N-tert-butyl-3-(4,6-dimethylpyrimidin-2-yl)sulfanylbenzamide.
| Compound Name | N-tert-butyl-3-(4,6-dimethylpyrimidin-2-yl)sulfanylbenzamide |
|---|---|
| PubChem CID | 4644875 |
| Molecular Formula | C17H21N3OS |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | N-tert-butyl-3-(4,6-dimethylpyrimidin-2-yl)sulfanylbenzamide |
| SMILES | Cc1cc(C)nc(Sc2cccc(C(=O)NC(C)(C)C)c2)n1 |
| InChI | InChI=1S/C17H21N3OS/c1-11-9-12(2)19-16(18-11)22-14-8-6-7-13(10-14)15(21)20-17(3,4)5/h6-10H,1-5H3,(H,20,21) |
| InChIKey | LAFWIGZDNORTLR-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |