C18H26N2O — CID 145015375
N-tert-butyl-2,4-dimethylquinoline-6-carboxamide;ethane (PubChem CID 145015375) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is N-tert-butyl-2,4-dimethylquinoline-6-carboxamide;ethane.
| Compound Name | N-tert-butyl-2,4-dimethylquinoline-6-carboxamide;ethane |
|---|---|
| PubChem CID | 145015375 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | N-tert-butyl-2,4-dimethylquinoline-6-carboxamide;ethane |
| SMILES | CC.Cc1cc(C)c2cc(C(=O)NC(C)(C)C)ccc2n1 |
| InChI | InChI=1S/C16H20N2O.C2H6/c1-10-8-11(2)17-14-7-6-12(9-13(10)14)15(19)18-16(3,4)5;1-2/h6-9H,1-5H3,(H,18,19);1-2H3 |
| InChIKey | WUBCATBMIUUOMF-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |