C28H29N5O2S — CID 46453161
N-[2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-4-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)butanamide (PubChem CID 46453161) has the molecular formula C28H29N5O2S and a molecular weight of 499.64 g/mol. Its IUPAC name is N-[2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-4-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)butanamide.
| Compound Name | N-[2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-4-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)butanamide |
|---|---|
| PubChem CID | 46453161 |
| Molecular Formula | C28H29N5O2S |
| Molecular Weight | 499.64 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | N-[2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-4-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)butanamide |
| SMILES | CN(C)c1ccc(C(CNC(=O)CCCc2nc(-c3cccs3)no2)c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C28H29N5O2S/c1-33(2)20-14-12-19(13-15-20)22(23-18-29-24-8-4-3-7-21(23)24)17-30-26(34)10-5-11-27-31-28(32-35-27)25-9-6-16-36-25/h3-4,6-9,12-16,18,22,29H,5,10-11,17H2,1-2H3,(H,30,34) |
| InChIKey | JMESCVKULGDALT-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.64 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|