C25H25N7O2S — CID 43043110
N-[2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-2-(5-oxo-4-thiophen-2-yltetrazol-1-yl)acetamide (PubChem CID 43043110) has the molecular formula C25H25N7O2S and a molecular weight of 487.59 g/mol. Its IUPAC name is N-[2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-2-(5-oxo-4-thiophen-2-yltetrazol-1-yl)acetamide.
| Compound Name | N-[2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-2-(5-oxo-4-thiophen-2-yltetrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 43043110 |
| Molecular Formula | C25H25N7O2S |
| Molecular Weight | 487.59 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | N-[2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-2-(5-oxo-4-thiophen-2-yltetrazol-1-yl)acetamide |
| SMILES | CN(C)c1ccc(C(CNC(=O)Cn2nnn(-c3cccs3)c2=O)c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C25H25N7O2S/c1-30(2)18-11-9-17(10-12-18)20(21-15-26-22-7-4-3-6-19(21)22)14-27-23(33)16-31-25(34)32(29-28-31)24-8-5-13-35-24/h3-13,15,20,26H,14,16H2,1-2H3,(H,27,33) |
| InChIKey | BMPXBKDFTURNQG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 100.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.59 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|