C18H20N2O4 — CID 46491540
methyl 6-[(5-tert-butyl-2-hydroxyphenyl)carbamoyl]pyridine-2-carboxylate (PubChem CID 46491540) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is methyl 6-[(5-tert-butyl-2-hydroxyphenyl)carbamoyl]pyridine-2-carboxylate.
| Compound Name | methyl 6-[(5-tert-butyl-2-hydroxyphenyl)carbamoyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 46491540 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | methyl 6-[(5-tert-butyl-2-hydroxyphenyl)carbamoyl]pyridine-2-carboxylate |
| SMILES | COC(=O)c1cccc(C(=O)Nc2cc(C(C)(C)C)ccc2O)n1 |
| InChI | InChI=1S/C18H20N2O4/c1-18(2,3)11-8-9-15(21)14(10-11)20-16(22)12-6-5-7-13(19-12)17(23)24-4/h5-10,21H,1-4H3,(H,20,22) |
| InChIKey | ZZPWNUQUUIUQNK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|