C12H14N4O6S — CID 46510748
ethyl 5-[[(2-methylfuran-3-carbonyl)amino]sulfamoyl]-1H-pyrazole-4-carboxylate (PubChem CID 46510748) has the molecular formula C12H14N4O6S and a molecular weight of 342.33 g/mol. Its IUPAC name is ethyl 5-[[(2-methylfuran-3-carbonyl)amino]sulfamoyl]-1H-pyrazole-4-carboxylate.
| Compound Name | ethyl 5-[[(2-methylfuran-3-carbonyl)amino]sulfamoyl]-1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 46510748 |
| Molecular Formula | C12H14N4O6S |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | ethyl 5-[[(2-methylfuran-3-carbonyl)amino]sulfamoyl]-1H-pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn[nH]c1S(=O)(=O)NNC(=O)c1ccoc1C |
| InChI | InChI=1S/C12H14N4O6S/c1-3-21-12(18)9-6-13-15-11(9)23(19,20)16-14-10(17)8-4-5-22-7(8)2/h4-6,16H,3H2,1-2H3,(H,13,15)(H,14,17) |
| InChIKey | LLGXQGLUNMQPTF-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 143.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|