C21H27ClN4O5 — CID 46520978
(E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-N-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]prop-2-enamide (PubChem CID 46520978) has the molecular formula C21H27ClN4O5 and a molecular weight of 450.92 g/mol. Its IUPAC name is (E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-N-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-N-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 46520978 |
| Molecular Formula | C21H27ClN4O5 |
| Molecular Weight | 450.92 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | (E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-N-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]prop-2-enamide |
| SMILES | CCCCn1nc(C)c(/C=C/C(=O)NCCc2cc(OC)c(OC)cc2[N+](=O)[O-])c1Cl |
| InChI | InChI=1S/C21H27ClN4O5/c1-5-6-11-25-21(22)16(14(2)24-25)7-8-20(27)23-10-9-15-12-18(30-3)19(31-4)13-17(15)26(28)29/h7-8,12-13H,5-6,9-11H2,1-4H3,(H,23,27)/b8-7+ |
| InChIKey | VNVYTCBNFZRPSY-BQYQJAHWSA-N |
| XLogP | 3.94 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.92 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|