C20H17F3N2O5 — CID 46531998
[1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 5,7-dimethoxy-1H-indole-2-carboxylate (PubChem CID 46531998) has the molecular formula C20H17F3N2O5 and a molecular weight of 422.36 g/mol. Its IUPAC name is [1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 5,7-dimethoxy-1H-indole-2-carboxylate.
| Compound Name | [1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 5,7-dimethoxy-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 46531998 |
| Molecular Formula | C20H17F3N2O5 |
| Molecular Weight | 422.36 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | [1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 5,7-dimethoxy-1H-indole-2-carboxylate |
| SMILES | COc1cc(OC)c2[nH]c(C(=O)OC(C)C(=O)Nc3ccc(F)c(F)c3F)cc2c1 |
| InChI | InChI=1S/C20H17F3N2O5/c1-9(19(26)25-13-5-4-12(21)16(22)17(13)23)30-20(27)14-7-10-6-11(28-2)8-15(29-3)18(10)24-14/h4-9,24H,1-3H3,(H,25,26) |
| InChIKey | BFBXAGUFQDKMFP-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.36 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|