C24H27N3O3S — CID 46534578
(E)-N-[(4-butan-2-ylphenyl)-thiophen-2-ylmethyl]-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)prop-2-enamide (PubChem CID 46534578) has the molecular formula C24H27N3O3S and a molecular weight of 437.57 g/mol. Its IUPAC name is (E)-N-[(4-butan-2-ylphenyl)-thiophen-2-ylmethyl]-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)prop-2-enamide.
| Compound Name | (E)-N-[(4-butan-2-ylphenyl)-thiophen-2-ylmethyl]-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 46534578 |
| Molecular Formula | C24H27N3O3S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | (E)-N-[(4-butan-2-ylphenyl)-thiophen-2-ylmethyl]-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)prop-2-enamide |
| SMILES | CCC(C)c1ccc(C(NC(=O)/C=C/c2cn(C)c(=O)n(C)c2=O)c2cccs2)cc1 |
| InChI | InChI=1S/C24H27N3O3S/c1-5-16(2)17-8-10-18(11-9-17)22(20-7-6-14-31-20)25-21(28)13-12-19-15-26(3)24(30)27(4)23(19)29/h6-16,22H,5H2,1-4H3,(H,25,28)/b13-12+ |
| InChIKey | FNFBTVVBMSANTB-OUKQBFOZSA-N |
| XLogP | 3.58 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|