C17H23N3O3S — CID 46575207
N-(2,6-dimethylphenyl)-4-[2-(2,5-dioxoimidazolidin-1-yl)ethylsulfanyl]butanamide (PubChem CID 46575207) has the molecular formula C17H23N3O3S and a molecular weight of 349.46 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-4-[2-(2,5-dioxoimidazolidin-1-yl)ethylsulfanyl]butanamide.
| Compound Name | N-(2,6-dimethylphenyl)-4-[2-(2,5-dioxoimidazolidin-1-yl)ethylsulfanyl]butanamide |
|---|---|
| PubChem CID | 46575207 |
| Molecular Formula | C17H23N3O3S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | N-(2,6-dimethylphenyl)-4-[2-(2,5-dioxoimidazolidin-1-yl)ethylsulfanyl]butanamide |
| SMILES | Cc1cccc(C)c1NC(=O)CCCSCCN1C(=O)CNC1=O |
| InChI | InChI=1S/C17H23N3O3S/c1-12-5-3-6-13(2)16(12)19-14(21)7-4-9-24-10-8-20-15(22)11-18-17(20)23/h3,5-6H,4,7-11H2,1-2H3,(H,18,23)(H,19,21) |
| InChIKey | VNOPPPHWKFCOPM-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|