C22H20N4O4S — CID 46578396
2,4,5-trimethyl-N'-[5-(phenoxymethyl)furan-2-carbonyl]thieno[2,3-d]pyrimidine-6-carbohydrazide (PubChem CID 46578396) has the molecular formula C22H20N4O4S and a molecular weight of 436.49 g/mol. Its IUPAC name is 2,4,5-trimethyl-N'-[5-(phenoxymethyl)furan-2-carbonyl]thieno[2,3-d]pyrimidine-6-carbohydrazide.
| Compound Name | 2,4,5-trimethyl-N'-[5-(phenoxymethyl)furan-2-carbonyl]thieno[2,3-d]pyrimidine-6-carbohydrazide |
|---|---|
| PubChem CID | 46578396 |
| Molecular Formula | C22H20N4O4S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 2,4,5-trimethyl-N'-[5-(phenoxymethyl)furan-2-carbonyl]thieno[2,3-d]pyrimidine-6-carbohydrazide |
| SMILES | Cc1nc(C)c2c(C)c(C(=O)NNC(=O)c3ccc(COc4ccccc4)o3)sc2n1 |
| InChI | InChI=1S/C22H20N4O4S/c1-12-18-13(2)23-14(3)24-22(18)31-19(12)21(28)26-25-20(27)17-10-9-16(30-17)11-29-15-7-5-4-6-8-15/h4-10H,11H2,1-3H3,(H,25,27)(H,26,28) |
| InChIKey | UPMDERAVDRCLHY-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|