C21H18N4O7 — CID 46609577
(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanoate (PubChem CID 46609577) has the molecular formula C21H18N4O7 and a molecular weight of 438.40 g/mol. Its IUPAC name is (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanoate.
| Compound Name | (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanoate |
|---|---|
| PubChem CID | 46609577 |
| Molecular Formula | C21H18N4O7 |
| Molecular Weight | 438.40 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanoate |
| SMILES | Cc1ccc2nc(COC(=O)CCCn3c(=O)oc4cc([N+](=O)[O-])ccc43)cc(=O)n2c1 |
| InChI | InChI=1S/C21H18N4O7/c1-13-4-7-18-22-14(9-19(26)24(18)11-13)12-31-20(27)3-2-8-23-16-6-5-15(25(29)30)10-17(16)32-21(23)28/h4-7,9-11H,2-3,8,12H2,1H3 |
| InChIKey | BOGSWYTTWRLWHG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 138.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.40 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|