C26H31N3O5S — CID 46662252
2-cyclohexyl-N-[[4-(diethylsulfamoyl)phenyl]methyl]-1,3-dioxoisoindole-5-carboxamide (PubChem CID 46662252) has the molecular formula C26H31N3O5S and a molecular weight of 497.62 g/mol. Its IUPAC name is 2-cyclohexyl-N-[[4-(diethylsulfamoyl)phenyl]methyl]-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-cyclohexyl-N-[[4-(diethylsulfamoyl)phenyl]methyl]-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 46662252 |
| Molecular Formula | C26H31N3O5S |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | 2-cyclohexyl-N-[[4-(diethylsulfamoyl)phenyl]methyl]-1,3-dioxoisoindole-5-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(CNC(=O)c2ccc3c(c2)C(=O)N(C2CCCCC2)C3=O)cc1 |
| InChI | InChI=1S/C26H31N3O5S/c1-3-28(4-2)35(33,34)21-13-10-18(11-14-21)17-27-24(30)19-12-15-22-23(16-19)26(32)29(25(22)31)20-8-6-5-7-9-20/h10-16,20H,3-9,17H2,1-2H3,(H,27,30) |
| InChIKey | DILJTYNCLWZMGS-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|