C20H21N3O3S2 — CID 46664029
N'-[2-(1,3-benzothiazol-2-ylmethoxy)acetyl]-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide (PubChem CID 46664029) has the molecular formula C20H21N3O3S2 and a molecular weight of 415.54 g/mol. Its IUPAC name is N'-[2-(1,3-benzothiazol-2-ylmethoxy)acetyl]-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide.
| Compound Name | N'-[2-(1,3-benzothiazol-2-ylmethoxy)acetyl]-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 46664029 |
| Molecular Formula | C20H21N3O3S2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | N'-[2-(1,3-benzothiazol-2-ylmethoxy)acetyl]-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide |
| SMILES | CC1CCc2sc(C(=O)NNC(=O)COCc3nc4ccccc4s3)cc2C1 |
| InChI | InChI=1S/C20H21N3O3S2/c1-12-6-7-15-13(8-12)9-17(27-15)20(25)23-22-18(24)10-26-11-19-21-14-4-2-3-5-16(14)28-19/h2-5,9,12H,6-8,10-11H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | GNWUTXRACBKQJL-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|