C24H25NO6S — CID 46670644
2-(1,3-dioxoisoindol-2-yl)ethyl 1-(2,5-dimethylphenyl)sulfonylcyclopentane-1-carboxylate (PubChem CID 46670644) has the molecular formula C24H25NO6S and a molecular weight of 455.53 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)ethyl 1-(2,5-dimethylphenyl)sulfonylcyclopentane-1-carboxylate.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 1-(2,5-dimethylphenyl)sulfonylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 46670644 |
| Molecular Formula | C24H25NO6S |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 1-(2,5-dimethylphenyl)sulfonylcyclopentane-1-carboxylate |
| SMILES | Cc1ccc(C)c(S(=O)(=O)C2(C(=O)OCCN3C(=O)c4ccccc4C3=O)CCCC2)c1 |
| InChI | InChI=1S/C24H25NO6S/c1-16-9-10-17(2)20(15-16)32(29,30)24(11-5-6-12-24)23(28)31-14-13-25-21(26)18-7-3-4-8-19(18)22(25)27/h3-4,7-10,15H,5-6,11-14H2,1-2H3 |
| InChIKey | RRGMMTKHQXAQFV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|