C24H41BO2 — CID 46702789
2-(2-butyl-7-tert-butyl-3,5,6,7,8,8a-hexahydronaphthalen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 46702789) has the molecular formula C24H41BO2 and a molecular weight of 372.40 g/mol. Its IUPAC name is 2-(2-butyl-7-tert-butyl-3,5,6,7,8,8a-hexahydronaphthalen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(2-butyl-7-tert-butyl-3,5,6,7,8,8a-hexahydronaphthalen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 46702789 |
| Molecular Formula | C24H41BO2 |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.32 |
| IUPAC Name | 2-(2-butyl-7-tert-butyl-3,5,6,7,8,8a-hexahydronaphthalen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCCCC1=C(B2OC(C)(C)C(C)(C)O2)C2CC(C(C)(C)C)CCC2=CC1 |
| InChI | InChI=1S/C24H41BO2/c1-9-10-11-18-13-12-17-14-15-19(22(2,3)4)16-20(17)21(18)25-26-23(5,6)24(7,8)27-25/h12,19-20H,9-11,13-16H2,1-8H3 |
| InChIKey | IZVHPRLZKBFTCO-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|