C12H15ClN6O2 — CID 4670624
N-[(3-chloro-4-methoxy-5-propan-2-yloxyphenyl)methylideneamino]-2H-tetrazol-5-amine (PubChem CID 4670624) has the molecular formula C12H15ClN6O2 and a molecular weight of 310.75 g/mol. Its IUPAC name is N-[(3-chloro-4-methoxy-5-propan-2-yloxyphenyl)methylideneamino]-2H-tetrazol-5-amine.
| Compound Name | N-[(3-chloro-4-methoxy-5-propan-2-yloxyphenyl)methylideneamino]-2H-tetrazol-5-amine |
|---|---|
| PubChem CID | 4670624 |
| Molecular Formula | C12H15ClN6O2 |
| Molecular Weight | 310.75 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | N-[(3-chloro-4-methoxy-5-propan-2-yloxyphenyl)methylideneamino]-2H-tetrazol-5-amine |
| SMILES | COc1c(Cl)cc(C=NNc2nn[nH]n2)cc1OC(C)C |
| InChI | InChI=1S/C12H15ClN6O2/c1-7(2)21-10-5-8(4-9(13)11(10)20-3)6-14-15-12-16-18-19-17-12/h4-7H,1-3H3,(H2,15,16,17,18,19) |
| InChIKey | WFXPHTOJUUXZDY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.75 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|