C27H24FN3O7S2 — CID 4672075
2-[(4-fluoro-2-methylphenyl)sulfonylamino]-N-[2-hydroxy-5-[(4-methoxyphenyl)sulfamoyl]phenyl]benzamide (PubChem CID 4672075) has the molecular formula C27H24FN3O7S2 and a molecular weight of 585.64 g/mol. Its IUPAC name is 2-[(4-fluoro-2-methylphenyl)sulfonylamino]-N-[2-hydroxy-5-[(4-methoxyphenyl)sulfamoyl]phenyl]benzamide.
| Compound Name | 2-[(4-fluoro-2-methylphenyl)sulfonylamino]-N-[2-hydroxy-5-[(4-methoxyphenyl)sulfamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 4672075 |
| Molecular Formula | C27H24FN3O7S2 |
| Molecular Weight | 585.64 g/mol |
| Exact Mass | 585.10 |
| IUPAC Name | 2-[(4-fluoro-2-methylphenyl)sulfonylamino]-N-[2-hydroxy-5-[(4-methoxyphenyl)sulfamoyl]phenyl]benzamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(O)c(NC(=O)c3ccccc3NS(=O)(=O)c3ccc(F)cc3C)c2)cc1 |
| InChI | InChI=1S/C27H24FN3O7S2/c1-17-15-18(28)7-14-26(17)40(36,37)31-23-6-4-3-5-22(23)27(33)29-24-16-21(12-13-25(24)32)39(34,35)30-19-8-10-20(38-2)11-9-19/h3-16,30-32H,1-2H3,(H,29,33) |
| InChIKey | YUMBVXQLDGOMRG-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 150.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.64 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|