C7H4INO — CID 46736890
6-iodofuro[3,2-b]pyridine (PubChem CID 46736890) has the molecular formula C7H4INO and a molecular weight of 245.02 g/mol. Its IUPAC name is 6-iodofuro[3,2-b]pyridine.
| Compound Name | 6-iodofuro[3,2-b]pyridine |
|---|---|
| PubChem CID | 46736890 |
| Molecular Formula | C7H4INO |
| Molecular Weight | 245.02 g/mol |
| Exact Mass | 244.93 |
| IUPAC Name | 6-iodofuro[3,2-b]pyridine |
| SMILES | Ic1cnc2ccoc2c1 |
| InChI | InChI=1S/C7H4INO/c8-5-3-7-6(9-4-5)1-2-10-7/h1-4H |
| InChIKey | CWYHCZNHNCLALA-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.02 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|