C18H23FN2O5 — CID 46790788
[2-(2-methoxyethylcarbamoylamino)-2-oxoethyl] 1-(4-fluorophenyl)cyclopentane-1-carboxylate (PubChem CID 46790788) has the molecular formula C18H23FN2O5 and a molecular weight of 366.39 g/mol. Its IUPAC name is [2-(2-methoxyethylcarbamoylamino)-2-oxoethyl] 1-(4-fluorophenyl)cyclopentane-1-carboxylate.
| Compound Name | [2-(2-methoxyethylcarbamoylamino)-2-oxoethyl] 1-(4-fluorophenyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 46790788 |
| Molecular Formula | C18H23FN2O5 |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | [2-(2-methoxyethylcarbamoylamino)-2-oxoethyl] 1-(4-fluorophenyl)cyclopentane-1-carboxylate |
| SMILES | COCCNC(=O)NC(=O)COC(=O)C1(c2ccc(F)cc2)CCCC1 |
| InChI | InChI=1S/C18H23FN2O5/c1-25-11-10-20-17(24)21-15(22)12-26-16(23)18(8-2-3-9-18)13-4-6-14(19)7-5-13/h4-7H,2-3,8-12H2,1H3,(H2,20,21,22,24) |
| InChIKey | DFIDJZQKDIGRAM-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|