C19H23BrN2O3S2 — CID 46796939
4-bromo-N-[2-(3,4-dimethylphenyl)sulfanylethyl]-3-(dimethylsulfamoyl)benzamide (PubChem CID 46796939) has the molecular formula C19H23BrN2O3S2 and a molecular weight of 471.44 g/mol. Its IUPAC name is 4-bromo-N-[2-(3,4-dimethylphenyl)sulfanylethyl]-3-(dimethylsulfamoyl)benzamide.
| Compound Name | 4-bromo-N-[2-(3,4-dimethylphenyl)sulfanylethyl]-3-(dimethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 46796939 |
| Molecular Formula | C19H23BrN2O3S2 |
| Molecular Weight | 471.44 g/mol |
| Exact Mass | 470.03 |
| IUPAC Name | 4-bromo-N-[2-(3,4-dimethylphenyl)sulfanylethyl]-3-(dimethylsulfamoyl)benzamide |
| SMILES | Cc1ccc(SCCNC(=O)c2ccc(Br)c(S(=O)(=O)N(C)C)c2)cc1C |
| InChI | InChI=1S/C19H23BrN2O3S2/c1-13-5-7-16(11-14(13)2)26-10-9-21-19(23)15-6-8-17(20)18(12-15)27(24,25)22(3)4/h5-8,11-12H,9-10H2,1-4H3,(H,21,23) |
| InChIKey | YOCJSGBMTCSJGS-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|