C19H21N3O2S2 — CID 4680759
5-(3-ethyl-4,5-dimethyl-1,3-thiazol-2-ylidene)-2-(3-hydroxyphenyl)imino-3-prop-2-enyl-1,3-thiazolidin-4-one (PubChem CID 4680759) has the molecular formula C19H21N3O2S2 and a molecular weight of 387.53 g/mol. Its IUPAC name is 5-(3-ethyl-4,5-dimethyl-1,3-thiazol-2-ylidene)-2-(3-hydroxyphenyl)imino-3-prop-2-enyl-1,3-thiazolidin-4-one.
| Compound Name | 5-(3-ethyl-4,5-dimethyl-1,3-thiazol-2-ylidene)-2-(3-hydroxyphenyl)imino-3-prop-2-enyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4680759 |
| Molecular Formula | C19H21N3O2S2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 5-(3-ethyl-4,5-dimethyl-1,3-thiazol-2-ylidene)-2-(3-hydroxyphenyl)imino-3-prop-2-enyl-1,3-thiazolidin-4-one |
| SMILES | C=CCN1C(=O)C(=C2SC(C)=C(C)N2CC)S/C1=N/c1cccc(O)c1 |
| InChI | InChI=1S/C19H21N3O2S2/c1-5-10-22-17(24)16(18-21(6-2)12(3)13(4)25-18)26-19(22)20-14-8-7-9-15(23)11-14/h5,7-9,11,23H,1,6,10H2,2-4H3/b18-16?,20-19+ |
| InChIKey | JKIYHVAPDQYVPS-KTUNAZLASA-N |
| XLogP | 4.63 |
| TPSA | 56.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|