C20H20Cl2N2O4 — CID 46819019
[2-[1-(3,4-dichlorophenyl)ethylamino]-2-oxoethyl] 4-(acetamidomethyl)benzoate (PubChem CID 46819019) has the molecular formula C20H20Cl2N2O4 and a molecular weight of 423.30 g/mol. Its IUPAC name is [2-[1-(3,4-dichlorophenyl)ethylamino]-2-oxoethyl] 4-(acetamidomethyl)benzoate.
| Compound Name | [2-[1-(3,4-dichlorophenyl)ethylamino]-2-oxoethyl] 4-(acetamidomethyl)benzoate |
|---|---|
| PubChem CID | 46819019 |
| Molecular Formula | C20H20Cl2N2O4 |
| Molecular Weight | 423.30 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | [2-[1-(3,4-dichlorophenyl)ethylamino]-2-oxoethyl] 4-(acetamidomethyl)benzoate |
| SMILES | CC(=O)NCc1ccc(C(=O)OCC(=O)NC(C)c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C20H20Cl2N2O4/c1-12(16-7-8-17(21)18(22)9-16)24-19(26)11-28-20(27)15-5-3-14(4-6-15)10-23-13(2)25/h3-9,12H,10-11H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | TVTNTRHBOAWZAT-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.30 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |