C25H26ClN5O3S — CID 46832305
4-(3-chlorophenyl)-2-[6-(4-morpholin-4-ylbutoxy)benzimidazol-1-yl]-1,3-thiazole-5-carboxamide (PubChem CID 46832305) has the molecular formula C25H26ClN5O3S and a molecular weight of 512.04 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-2-[6-(4-morpholin-4-ylbutoxy)benzimidazol-1-yl]-1,3-thiazole-5-carboxamide.
| Compound Name | 4-(3-chlorophenyl)-2-[6-(4-morpholin-4-ylbutoxy)benzimidazol-1-yl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 46832305 |
| Molecular Formula | C25H26ClN5O3S |
| Molecular Weight | 512.04 g/mol |
| Exact Mass | 511.14 |
| IUPAC Name | 4-(3-chlorophenyl)-2-[6-(4-morpholin-4-ylbutoxy)benzimidazol-1-yl]-1,3-thiazole-5-carboxamide |
| SMILES | NC(=O)c1sc(-n2cnc3ccc(OCCCCN4CCOCC4)cc32)nc1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C25H26ClN5O3S/c26-18-5-3-4-17(14-18)22-23(24(27)32)35-25(29-22)31-16-28-20-7-6-19(15-21(20)31)34-11-2-1-8-30-9-12-33-13-10-30/h3-7,14-16H,1-2,8-13H2,(H2,27,32) |
| InChIKey | RNGHEGTWBPVIAP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.04 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|