C28H23Cl2F3N4O4 — CID 46832410
N-[(3E)-3-[4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylphenoxy]imino-2-oxopropyl]-N-(pyridin-2-ylmethyl)acetamide (PubChem CID 46832410) has the molecular formula C28H23Cl2F3N4O4 and a molecular weight of 607.42 g/mol. Its IUPAC name is N-[(3E)-3-[4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylphenoxy]imino-2-oxopropyl]-N-(pyridin-2-ylmethyl)acetamide.
| Compound Name | N-[(3E)-3-[4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylphenoxy]imino-2-oxopropyl]-N-(pyridin-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 46832410 |
| Molecular Formula | C28H23Cl2F3N4O4 |
| Molecular Weight | 607.42 g/mol |
| Exact Mass | 606.10 |
| IUPAC Name | N-[(3E)-3-[4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylphenoxy]imino-2-oxopropyl]-N-(pyridin-2-ylmethyl)acetamide |
| SMILES | CC(=O)N(CC(=O)/C=N/Oc1ccc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)cc1C)Cc1ccccn1 |
| InChI | InChI=1S/C28H23Cl2F3N4O4/c1-17-9-19(25-13-27(41-36-25,28(31,32)33)20-10-21(29)12-22(30)11-20)6-7-26(17)40-35-14-24(39)16-37(18(2)38)15-23-5-3-4-8-34-23/h3-12,14H,13,15-16H2,1-2H3/b35-14+ |
| InChIKey | CYQDDOZMDLBZQQ-YRJKAGBCSA-N |
| XLogP | 6.26 |
| TPSA | 93.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.42 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|