C22H33N3O3S2 — CID 4683733
(5-methyl-2-propan-2-ylcyclohexyl) 2-[2-[(ethylcarbamothioylamino)carbamoyl]phenyl]sulfanylacetate (PubChem CID 4683733) has the molecular formula C22H33N3O3S2 and a molecular weight of 451.66 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) 2-[2-[(ethylcarbamothioylamino)carbamoyl]phenyl]sulfanylacetate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-[2-[(ethylcarbamothioylamino)carbamoyl]phenyl]sulfanylacetate |
|---|---|
| PubChem CID | 4683733 |
| Molecular Formula | C22H33N3O3S2 |
| Molecular Weight | 451.66 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-[2-[(ethylcarbamothioylamino)carbamoyl]phenyl]sulfanylacetate |
| SMILES | CCNC(=S)NNC(=O)c1ccccc1SCC(=O)OC1CC(C)CCC1C(C)C |
| InChI | InChI=1S/C22H33N3O3S2/c1-5-23-22(29)25-24-21(27)17-8-6-7-9-19(17)30-13-20(26)28-18-12-15(4)10-11-16(18)14(2)3/h6-9,14-16,18H,5,10-13H2,1-4H3,(H,24,27)(H2,23,25,29) |
| InChIKey | UYEDDAYMPPWDDZ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.66 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|