C9H6N2 — CID 46838759
3-ethynylimidazo[1,2-a]pyridine (PubChem CID 46838759) has the molecular formula C9H6N2 and a molecular weight of 142.16 g/mol. Its IUPAC name is 3-ethynylimidazo[1,2-a]pyridine.
| Compound Name | 3-ethynylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 46838759 |
| Molecular Formula | C9H6N2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.05 |
| IUPAC Name | 3-ethynylimidazo[1,2-a]pyridine |
| SMILES | C#Cc1cnc2ccccn12 |
| InChI | InChI=1S/C9H6N2/c1-2-8-7-10-9-5-3-4-6-11(8)9/h1,3-7H |
| InChIKey | FBTDPECEFKOJQL-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|