C30H29BrN2O2S — CID 46840249
2-[2-[(E)-2-(9-benzyl-4b,5,6,7,8,8a-hexahydrocarbazol-3-yl)ethenyl]-1,3-benzothiazol-3-ium-3-yl]acetic acid bromide (PubChem CID 46840249) has the molecular formula C30H29BrN2O2S and a molecular weight of 561.55 g/mol. Its IUPAC name is 2-[2-[(E)-2-(9-benzyl-4b,5,6,7,8,8a-hexahydrocarbazol-3-yl)ethenyl]-1,3-benzothiazol-3-ium-3-yl]acetic acid bromide.
| Compound Name | 2-[2-[(E)-2-(9-benzyl-4b,5,6,7,8,8a-hexahydrocarbazol-3-yl)ethenyl]-1,3-benzothiazol-3-ium-3-yl]acetic acid bromide |
|---|---|
| PubChem CID | 46840249 |
| Molecular Formula | C30H29BrN2O2S |
| Molecular Weight | 561.55 g/mol |
| Exact Mass | 560.11 |
| IUPAC Name | 2-[2-[(E)-2-(9-benzyl-4b,5,6,7,8,8a-hexahydrocarbazol-3-yl)ethenyl]-1,3-benzothiazol-3-ium-3-yl]acetic acid bromide |
| SMILES | O=C(O)C[n+]1c(/C=C/c2ccc3c(c2)C2CCCCC2N3Cc2ccccc2)sc2ccccc21.[Br-] |
| InChI | InChI=1S/C30H28N2O2S.BrH/c33-30(34)20-32-27-12-6-7-13-28(27)35-29(32)17-15-21-14-16-26-24(18-21)23-10-4-5-11-25(23)31(26)19-22-8-2-1-3-9-22;/h1-3,6-9,12-18,23,25H,4-5,10-11,19-20H2;1H |
| InChIKey | DKXFCZBMHQFEOG-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 44.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.55 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|