C29H27N2O2S+ — CID 76788052
[2-[2-(4-benzyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl)ethenyl]-1,3-benzothiazol-3-ium-3-yl]methyl formate (PubChem CID 76788052) has the molecular formula C29H27N2O2S+ and a molecular weight of 467.61 g/mol. Its IUPAC name is [2-[2-(4-benzyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl)ethenyl]-1,3-benzothiazol-3-ium-3-yl]methyl formate.
| Compound Name | [2-[2-(4-benzyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl)ethenyl]-1,3-benzothiazol-3-ium-3-yl]methyl formate |
|---|---|
| PubChem CID | 76788052 |
| Molecular Formula | C29H27N2O2S+ |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | [2-[2-(4-benzyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl)ethenyl]-1,3-benzothiazol-3-ium-3-yl]methyl formate |
| SMILES | O=COC[n+]1c(C=Cc2ccc3c(c2)C2CCCC2N3Cc2ccccc2)sc2ccccc21 |
| InChI | InChI=1S/C29H27N2O2S/c32-20-33-19-31-27-10-4-5-12-28(27)34-29(31)16-14-21-13-15-26-24(17-21)23-9-6-11-25(23)30(26)18-22-7-2-1-3-8-22/h1-5,7-8,10,12-17,20,23,25H,6,9,11,18-19H2/q+1 |
| InChIKey | LANQHYLRNJRGPP-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|