C19H26O3 — CID 46844716
(1S)-1-[(5S,6R,8S)-8-phenylmethoxy-1-oxaspiro[4.6]undec-3-en-6-yl]ethanol (PubChem CID 46844716) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is (1S)-1-[(5S,6R,8S)-8-phenylmethoxy-1-oxaspiro[4.6]undec-3-en-6-yl]ethanol.
| Compound Name | (1S)-1-[(5S,6R,8S)-8-phenylmethoxy-1-oxaspiro[4.6]undec-3-en-6-yl]ethanol |
|---|---|
| PubChem CID | 46844716 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | (1S)-1-[(5S,6R,8S)-8-phenylmethoxy-1-oxaspiro[4.6]undec-3-en-6-yl]ethanol |
| SMILES | C[C@H](O)[C@H]1C[C@@H](OCc2ccccc2)CCC[C@]12C=CCO2 |
| InChI | InChI=1S/C19H26O3/c1-15(20)18-13-17(21-14-16-7-3-2-4-8-16)9-5-10-19(18)11-6-12-22-19/h2-4,6-8,11,15,17-18,20H,5,9-10,12-14H2,1H3/t15-,17-,18+,19-/m0/s1 |
| InChIKey | OYSKDAXJTHTVOK-KANFNMMFSA-N |
| XLogP | 3.47 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|