C31H38O6 — CID 46848258
(1S,2E,5S,8E,10Z,14E,17S)-5-[(4-methoxyphenyl)methoxymethyl]-3,11-dimethyl-19-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-2,8,10,14-tetraene-7,13-dione (PubChem CID 46848258) has the molecular formula C31H38O6 and a molecular weight of 506.64 g/mol. Its IUPAC name is (1S,2E,5S,8E,10Z,14E,17S)-5-[(4-methoxyphenyl)methoxymethyl]-3,11-dimethyl-19-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-2,8,10,14-tetraene-7,13-dione.
| Compound Name | (1S,2E,5S,8E,10Z,14E,17S)-5-[(4-methoxyphenyl)methoxymethyl]-3,11-dimethyl-19-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-2,8,10,14-tetraene-7,13-dione |
|---|---|
| PubChem CID | 46848258 |
| Molecular Formula | C31H38O6 |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.27 |
| IUPAC Name | (1S,2E,5S,8E,10Z,14E,17S)-5-[(4-methoxyphenyl)methoxymethyl]-3,11-dimethyl-19-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-2,8,10,14-tetraene-7,13-dione |
| SMILES | C=C1C[C@@H]2C/C=C/C(=O)C/C(C)=C\C=C\C(=O)O[C@H](COCc3ccc(OC)cc3)C/C(C)=C/[C@H](C1)O2 |
| InChI | InChI=1S/C31H38O6/c1-22-7-5-10-31(33)37-30(21-35-20-25-11-13-27(34-4)14-12-25)19-24(3)18-29-17-23(2)16-28(36-29)9-6-8-26(32)15-22/h5-8,10-14,18,28-30H,2,9,15-17,19-21H2,1,3-4H3/b8-6+,10-5+,22-7-,24-18+/t28-,29-,30-/m0/s1 |
| InChIKey | LQTLHBCDSSMMQL-BVBBDCQMSA-N |
| XLogP | 5.99 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|