C28H32O8S — CID 46848326
[6-methoxy-2-propan-2-yloxy-3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] 4-methylbenzenesulfonate (PubChem CID 46848326) has the molecular formula C28H32O8S and a molecular weight of 528.62 g/mol. Its IUPAC name is [6-methoxy-2-propan-2-yloxy-3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [6-methoxy-2-propan-2-yloxy-3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 46848326 |
| Molecular Formula | C28H32O8S |
| Molecular Weight | 528.62 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | [6-methoxy-2-propan-2-yloxy-3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] 4-methylbenzenesulfonate |
| SMILES | COc1cc(/C=C\c2ccc(OC)c(OS(=O)(=O)c3ccc(C)cc3)c2OC(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C28H32O8S/c1-18(2)35-26-21(11-10-20-16-24(32-5)27(34-7)25(17-20)33-6)12-15-23(31-4)28(26)36-37(29,30)22-13-8-19(3)9-14-22/h8-18H,1-7H3/b11-10- |
| InChIKey | NUKNIRIJTBINNV-KHPPLWFESA-N |
| XLogP | 5.75 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.62 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|