C29H37N3O3S — CID 46852764
4-[4-[4-(2-cyclohexyl-5-ethyl-1,3-thiazol-4-yl)phenoxy]butoxy]-N'-methoxybenzenecarboximidamide (PubChem CID 46852764) has the molecular formula C29H37N3O3S and a molecular weight of 507.70 g/mol. Its IUPAC name is 4-[4-[4-(2-cyclohexyl-5-ethyl-1,3-thiazol-4-yl)phenoxy]butoxy]-N'-methoxybenzenecarboximidamide.
| Compound Name | 4-[4-[4-(2-cyclohexyl-5-ethyl-1,3-thiazol-4-yl)phenoxy]butoxy]-N'-methoxybenzenecarboximidamide |
|---|---|
| PubChem CID | 46852764 |
| Molecular Formula | C29H37N3O3S |
| Molecular Weight | 507.70 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | 4-[4-[4-(2-cyclohexyl-5-ethyl-1,3-thiazol-4-yl)phenoxy]butoxy]-N'-methoxybenzenecarboximidamide |
| SMILES | CCc1sc(C2CCCCC2)nc1-c1ccc(OCCCCOc2ccc(/C(N)=N\OC)cc2)cc1 |
| InChI | InChI=1S/C29H37N3O3S/c1-3-26-27(31-29(36-26)23-9-5-4-6-10-23)21-11-15-24(16-12-21)34-19-7-8-20-35-25-17-13-22(14-18-25)28(30)32-33-2/h11-18,23H,3-10,19-20H2,1-2H3,(H2,30,32) |
| InChIKey | ISYJVAFOUMJSOI-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.70 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|