C16H18ClF3N2O3S — CID 46853680
1-[1-[2-chloro-4-(trifluoromethyl)phenyl]sulfonylpiperidin-3-yl]pyrrolidin-2-one (PubChem CID 46853680) has the molecular formula C16H18ClF3N2O3S and a molecular weight of 410.85 g/mol. Its IUPAC name is 1-[1-[2-chloro-4-(trifluoromethyl)phenyl]sulfonylpiperidin-3-yl]pyrrolidin-2-one.
| Compound Name | 1-[1-[2-chloro-4-(trifluoromethyl)phenyl]sulfonylpiperidin-3-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 46853680 |
| Molecular Formula | C16H18ClF3N2O3S |
| Molecular Weight | 410.85 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | 1-[1-[2-chloro-4-(trifluoromethyl)phenyl]sulfonylpiperidin-3-yl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1C1CCCN(S(=O)(=O)c2ccc(C(F)(F)F)cc2Cl)C1 |
| InChI | InChI=1S/C16H18ClF3N2O3S/c17-13-9-11(16(18,19)20)5-6-14(13)26(24,25)21-7-1-3-12(10-21)22-8-2-4-15(22)23/h5-6,9,12H,1-4,7-8,10H2 |
| InChIKey | LUCKGGMZHSFLGA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.85 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |