C20H15Cl2N7OS — CID 46866476
4-(2,4-dichlorophenyl)-2-[2-(2-methoxyethylamino)pyrimidin-4-yl]-5-(1H-1,2,4-triazol-5-yl)thiophene-3-carbonitrile (PubChem CID 46866476) has the molecular formula C20H15Cl2N7OS and a molecular weight of 472.36 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-2-[2-(2-methoxyethylamino)pyrimidin-4-yl]-5-(1H-1,2,4-triazol-5-yl)thiophene-3-carbonitrile.
| Compound Name | 4-(2,4-dichlorophenyl)-2-[2-(2-methoxyethylamino)pyrimidin-4-yl]-5-(1H-1,2,4-triazol-5-yl)thiophene-3-carbonitrile |
|---|---|
| PubChem CID | 46866476 |
| Molecular Formula | C20H15Cl2N7OS |
| Molecular Weight | 472.36 g/mol |
| Exact Mass | 471.04 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-2-[2-(2-methoxyethylamino)pyrimidin-4-yl]-5-(1H-1,2,4-triazol-5-yl)thiophene-3-carbonitrile |
| SMILES | COCCNc1nccc(-c2sc(-c3ncn[nH]3)c(-c3ccc(Cl)cc3Cl)c2C#N)n1 |
| InChI | InChI=1S/C20H15Cl2N7OS/c1-30-7-6-25-20-24-5-4-15(28-20)17-13(9-23)16(12-3-2-11(21)8-14(12)22)18(31-17)19-26-10-27-29-19/h2-5,8,10H,6-7H2,1H3,(H,24,25,28)(H,26,27,29) |
| InChIKey | ZOBRYFSHNWJJJL-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 112.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.36 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|