C13H19N2O4PS — CID 46885672
4-[[[1-aminobutyl(hydroxy)phosphoryl]carbothioylamino]methyl]benzoic acid (PubChem CID 46885672) has the molecular formula C13H19N2O4PS and a molecular weight of 330.35 g/mol. Its IUPAC name is 4-[[[1-aminobutyl(hydroxy)phosphoryl]carbothioylamino]methyl]benzoic acid.
| Compound Name | 4-[[[1-aminobutyl(hydroxy)phosphoryl]carbothioylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 46885672 |
| Molecular Formula | C13H19N2O4PS |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 4-[[[1-aminobutyl(hydroxy)phosphoryl]carbothioylamino]methyl]benzoic acid |
| SMILES | CCCC(N)P(=O)(O)C(=S)NCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C13H19N2O4PS/c1-2-3-11(14)20(18,19)13(21)15-8-9-4-6-10(7-5-9)12(16)17/h4-7,11H,2-3,8,14H2,1H3,(H,15,21)(H,16,17)(H,18,19) |
| InChIKey | UUSRHEINVQBSBQ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|