C17H21ClO3 — CID 46895073
[6-(2-chloroethyl)cyclohexen-1-yl]-(3,4-dimethoxyphenyl)methanone (PubChem CID 46895073) has the molecular formula C17H21ClO3 and a molecular weight of 308.81 g/mol. Its IUPAC name is [6-(2-chloroethyl)cyclohexen-1-yl]-(3,4-dimethoxyphenyl)methanone.
| Compound Name | [6-(2-chloroethyl)cyclohexen-1-yl]-(3,4-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 46895073 |
| Molecular Formula | C17H21ClO3 |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | [6-(2-chloroethyl)cyclohexen-1-yl]-(3,4-dimethoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)C2=CCCCC2CCCl)cc1OC |
| InChI | InChI=1S/C17H21ClO3/c1-20-15-8-7-13(11-16(15)21-2)17(19)14-6-4-3-5-12(14)9-10-18/h6-8,11-12H,3-5,9-10H2,1-2H3 |
| InChIKey | AVWLULUYWUSVFJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|