C19H31NO3S — CID 46895255
butyl (E)-3-[2-(5-hydroxynonan-5-yl)-1,3-thiazol-5-yl]prop-2-enoate (PubChem CID 46895255) has the molecular formula C19H31NO3S and a molecular weight of 353.53 g/mol. Its IUPAC name is butyl (E)-3-[2-(5-hydroxynonan-5-yl)-1,3-thiazol-5-yl]prop-2-enoate.
| Compound Name | butyl (E)-3-[2-(5-hydroxynonan-5-yl)-1,3-thiazol-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 46895255 |
| Molecular Formula | C19H31NO3S |
| Molecular Weight | 353.53 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | butyl (E)-3-[2-(5-hydroxynonan-5-yl)-1,3-thiazol-5-yl]prop-2-enoate |
| SMILES | CCCCOC(=O)/C=C/c1cnc(C(O)(CCCC)CCCC)s1 |
| InChI | InChI=1S/C19H31NO3S/c1-4-7-12-19(22,13-8-5-2)18-20-15-16(24-18)10-11-17(21)23-14-9-6-3/h10-11,15,22H,4-9,12-14H2,1-3H3/b11-10+ |
| InChIKey | WQSNFDNQVZTOEI-ZHACJKMWSA-N |
| XLogP | 5.07 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.53 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|