C14H14N4O2 — CID 46902447
prop-2-enyl 4,6-dihydrotriazolo[1,5-a][1,4]benzodiazepine-5-carboxylate (PubChem CID 46902447) has the molecular formula C14H14N4O2 and a molecular weight of 270.29 g/mol. Its IUPAC name is prop-2-enyl 4,6-dihydrotriazolo[1,5-a][1,4]benzodiazepine-5-carboxylate.
| Compound Name | prop-2-enyl 4,6-dihydrotriazolo[1,5-a][1,4]benzodiazepine-5-carboxylate |
|---|---|
| PubChem CID | 46902447 |
| Molecular Formula | C14H14N4O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | prop-2-enyl 4,6-dihydrotriazolo[1,5-a][1,4]benzodiazepine-5-carboxylate |
| SMILES | C=CCOC(=O)N1Cc2ccccc2-n2nncc2C1 |
| InChI | InChI=1S/C14H14N4O2/c1-2-7-20-14(19)17-9-11-5-3-4-6-13(11)18-12(10-17)8-15-16-18/h2-6,8H,1,7,9-10H2 |
| InChIKey | YGLJRUFBIHEUNG-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|