C21H24N2O2 — CID 46902459
1-[(3aR,6S,7aS)-1-methyl-6-(4-phenylphenyl)-3,3a,4,6,7,7a-hexahydro-[1,2]oxazolo[4,3-c]pyridin-5-yl]ethanone (PubChem CID 46902459) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 1-[(3aR,6S,7aS)-1-methyl-6-(4-phenylphenyl)-3,3a,4,6,7,7a-hexahydro-[1,2]oxazolo[4,3-c]pyridin-5-yl]ethanone.
| Compound Name | 1-[(3aR,6S,7aS)-1-methyl-6-(4-phenylphenyl)-3,3a,4,6,7,7a-hexahydro-[1,2]oxazolo[4,3-c]pyridin-5-yl]ethanone |
|---|---|
| PubChem CID | 46902459 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 1-[(3aR,6S,7aS)-1-methyl-6-(4-phenylphenyl)-3,3a,4,6,7,7a-hexahydro-[1,2]oxazolo[4,3-c]pyridin-5-yl]ethanone |
| SMILES | CC(=O)N1C[C@H]2CON(C)[C@H]2C[C@H]1c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H24N2O2/c1-15(24)23-13-19-14-25-22(2)20(19)12-21(23)18-10-8-17(9-11-18)16-6-4-3-5-7-16/h3-11,19-21H,12-14H2,1-2H3/t19-,20-,21-/m0/s1 |
| InChIKey | AVFLVCPGZJLNFT-ACRUOGEOSA-N |
| XLogP | 3.51 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |