C19H24N2O5 — CID 46905307
(E)-but-2-enedioic acid;3-(2-piperidin-4-ylethyl)-1H-indol-5-ol (PubChem CID 46905307) has the molecular formula C19H24N2O5 and a molecular weight of 360.41 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;3-(2-piperidin-4-ylethyl)-1H-indol-5-ol.
| Compound Name | (E)-but-2-enedioic acid;3-(2-piperidin-4-ylethyl)-1H-indol-5-ol |
|---|---|
| PubChem CID | 46905307 |
| Molecular Formula | C19H24N2O5 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | (E)-but-2-enedioic acid;3-(2-piperidin-4-ylethyl)-1H-indol-5-ol |
| SMILES | O=C(O)/C=C/C(=O)O.Oc1ccc2[nH]cc(CCC3CCNCC3)c2c1 |
| InChI | InChI=1S/C15H20N2O.C4H4O4/c18-13-3-4-15-14(9-13)12(10-17-15)2-1-11-5-7-16-8-6-11;5-3(6)1-2-4(7)8/h3-4,9-11,16-18H,1-2,5-8H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | GFALBLFYNPKAAO-WLHGVMLRSA-N |
| XLogP | 2.52 |
| TPSA | 122.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|