C10H17N5O12P3+ — CID 46905539
[[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-trihydroxyphosphanium (PubChem CID 46905539) has the molecular formula C10H17N5O12P3+ and a molecular weight of 492.19 g/mol. Its IUPAC name is [[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-trihydroxyphosphanium.
| Compound Name | [[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-trihydroxyphosphanium |
|---|---|
| PubChem CID | 46905539 |
| Molecular Formula | C10H17N5O12P3+ |
| Molecular Weight | 492.19 g/mol |
| Exact Mass | 492.01 |
| IUPAC Name | [[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-trihydroxyphosphanium |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CP(=O)(O)OP(=O)(O)O[P+](O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H16N5O12P3/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(25-10)1-28(18,19)26-30(23,24)27-29(20,21)22/h2-4,6-7,10,16-17,20-22H,1H2,(H3-,11,12,13,18,19,23,24)/p+1/t4-,6-,7-,10-/m1/s1 |
| InChIKey | BUMCUBXDYOPKAD-KQYNXXCUSA-O |
| XLogP | -2.00 |
| TPSA | 273.06 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.19 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|