C20H19ClN+ — CID 46930833
6-(3-chloropropyl)-8,9-dihydroisoquinolino[1,2-a]isoquinolin-7-ium (PubChem CID 46930833) has the molecular formula C20H19ClN+ and a molecular weight of 308.83 g/mol. Its IUPAC name is 6-(3-chloropropyl)-8,9-dihydroisoquinolino[1,2-a]isoquinolin-7-ium.
| Compound Name | 6-(3-chloropropyl)-8,9-dihydroisoquinolino[1,2-a]isoquinolin-7-ium |
|---|---|
| PubChem CID | 46930833 |
| Molecular Formula | C20H19ClN+ |
| Molecular Weight | 308.83 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 6-(3-chloropropyl)-8,9-dihydroisoquinolino[1,2-a]isoquinolin-7-ium |
| SMILES | ClCCCc1cc2ccccc2c2[n+]1CCc1ccccc1-2 |
| InChI | InChI=1S/C20H19ClN/c21-12-5-8-17-14-16-7-2-4-10-19(16)20-18-9-3-1-6-15(18)11-13-22(17)20/h1-4,6-7,9-10,14H,5,8,11-13H2/q+1 |
| InChIKey | DVAMRLQVWFMASB-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.83 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|