C25H30F6NO2Sb — CID 46928909
hexafluoroantimony(1-);8-hexyl-2,3-dimethoxy-5,6-dihydroisoquinolino[1,2-a]isoquinolin-7-ium (PubChem CID 46928909) has the molecular formula C25H30F6NO2Sb and a molecular weight of 612.27 g/mol. Its IUPAC name is hexafluoroantimony(1-);8-hexyl-2,3-dimethoxy-5,6-dihydroisoquinolino[1,2-a]isoquinolin-7-ium.
| Compound Name | hexafluoroantimony(1-);8-hexyl-2,3-dimethoxy-5,6-dihydroisoquinolino[1,2-a]isoquinolin-7-ium |
|---|---|
| PubChem CID | 46928909 |
| Molecular Formula | C25H30F6NO2Sb |
| Molecular Weight | 612.27 g/mol |
| Exact Mass | 611.12 |
| IUPAC Name | hexafluoroantimony(1-);8-hexyl-2,3-dimethoxy-5,6-dihydroisoquinolino[1,2-a]isoquinolin-7-ium |
| SMILES | CCCCCCc1cc2ccccc2c2[n+]1CCc1cc(OC)c(OC)cc1-2.F[Sb-](F)(F)(F)(F)F |
| InChI | InChI=1S/C25H30NO2.6FH.Sb/c1-4-5-6-7-11-20-15-18-10-8-9-12-21(18)25-22-17-24(28-3)23(27-2)16-19(22)13-14-26(20)25;;;;;;;/h8-10,12,15-17H,4-7,11,13-14H2,1-3H3;6*1H;/q+1;;;;;;;+5/p-6 |
| InChIKey | ZLHWEHOLILRKCB-UHFFFAOYSA-H |
| XLogP | 7.63 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.27 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|