C20H15BrClN3O2 — CID 46933624
4-bromo-1-[3-[(7-chloroquinolin-4-yl)amino]propyl]indole-2,3-dione (PubChem CID 46933624) has the molecular formula C20H15BrClN3O2 and a molecular weight of 444.72 g/mol. Its IUPAC name is 4-bromo-1-[3-[(7-chloroquinolin-4-yl)amino]propyl]indole-2,3-dione.
| Compound Name | 4-bromo-1-[3-[(7-chloroquinolin-4-yl)amino]propyl]indole-2,3-dione |
|---|---|
| PubChem CID | 46933624 |
| Molecular Formula | C20H15BrClN3O2 |
| Molecular Weight | 444.72 g/mol |
| Exact Mass | 443.00 |
| IUPAC Name | 4-bromo-1-[3-[(7-chloroquinolin-4-yl)amino]propyl]indole-2,3-dione |
| SMILES | O=C1C(=O)N(CCCNc2ccnc3cc(Cl)ccc23)c2cccc(Br)c21 |
| InChI | InChI=1S/C20H15BrClN3O2/c21-14-3-1-4-17-18(14)19(26)20(27)25(17)10-2-8-23-15-7-9-24-16-11-12(22)5-6-13(15)16/h1,3-7,9,11H,2,8,10H2,(H,23,24) |
| InChIKey | FYPOAFZMPVPEHD-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.72 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|