C23H18Cl2N6O2 — CID 71717690
5-chloro-1-[[3-[3-[(7-chloroquinolin-4-yl)amino]propyl]triazol-4-yl]methyl]indole-2,3-dione (PubChem CID 71717690) has the molecular formula C23H18Cl2N6O2 and a molecular weight of 481.34 g/mol. Its IUPAC name is 5-chloro-1-[[3-[3-[(7-chloroquinolin-4-yl)amino]propyl]triazol-4-yl]methyl]indole-2,3-dione.
| Compound Name | 5-chloro-1-[[3-[3-[(7-chloroquinolin-4-yl)amino]propyl]triazol-4-yl]methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 71717690 |
| Molecular Formula | C23H18Cl2N6O2 |
| Molecular Weight | 481.34 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | 5-chloro-1-[[3-[3-[(7-chloroquinolin-4-yl)amino]propyl]triazol-4-yl]methyl]indole-2,3-dione |
| SMILES | O=C1C(=O)N(Cc2cnnn2CCCNc2ccnc3cc(Cl)ccc23)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C23H18Cl2N6O2/c24-14-3-5-21-18(10-14)22(32)23(33)30(21)13-16-12-28-29-31(16)9-1-7-26-19-6-8-27-20-11-15(25)2-4-17(19)20/h2-6,8,10-12H,1,7,9,13H2,(H,26,27) |
| InChIKey | JVBYLCHDFZJSON-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.34 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|