C17H14N2O2 — CID 46935908
1-methyl-4-phenyl-3,4-dihydro-[1]benzofuro[3,2-d]pyrimidin-2-one (PubChem CID 46935908) has the molecular formula C17H14N2O2 and a molecular weight of 278.31 g/mol. Its IUPAC name is 1-methyl-4-phenyl-3,4-dihydro-[1]benzofuro[3,2-d]pyrimidin-2-one.
| Compound Name | 1-methyl-4-phenyl-3,4-dihydro-[1]benzofuro[3,2-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 46935908 |
| Molecular Formula | C17H14N2O2 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 1-methyl-4-phenyl-3,4-dihydro-[1]benzofuro[3,2-d]pyrimidin-2-one |
| SMILES | CN1C(=O)NC(c2ccccc2)c2oc3ccccc3c21 |
| InChI | InChI=1S/C17H14N2O2/c1-19-15-12-9-5-6-10-13(12)21-16(15)14(18-17(19)20)11-7-3-2-4-8-11/h2-10,14H,1H3,(H,18,20) |
| InChIKey | RZGXLAYHCMZAQA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |